C15H19BrN4O2 — CID 119127821
2-bromo-5-methoxy-N-[3-(1H-pyrazol-5-ylmethylamino)propyl]benzamide (PubChem CID 119127821) has the molecular formula C15H19BrN4O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-[3-(1H-pyrazol-5-ylmethylamino)propyl]benzamide.
| Compound Name | 2-bromo-5-methoxy-N-[3-(1H-pyrazol-5-ylmethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 119127821 |
| Molecular Formula | C15H19BrN4O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-bromo-5-methoxy-N-[3-(1H-pyrazol-5-ylmethylamino)propyl]benzamide |
| SMILES | COc1ccc(Br)c(C(=O)NCCCNCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C15H19BrN4O2/c1-22-12-3-4-14(16)13(9-12)15(21)18-7-2-6-17-10-11-5-8-19-20-11/h3-5,8-9,17H,2,6-7,10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | CNPYFSWPNRUIGH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|