C16H21NO2 — CID 119128559
2-methyl-1-[[5-(4-methylphenyl)furan-2-yl]methylamino]propan-2-ol (PubChem CID 119128559) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-methyl-1-[[5-(4-methylphenyl)furan-2-yl]methylamino]propan-2-ol.
| Compound Name | 2-methyl-1-[[5-(4-methylphenyl)furan-2-yl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 119128559 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-methyl-1-[[5-(4-methylphenyl)furan-2-yl]methylamino]propan-2-ol |
| SMILES | Cc1ccc(-c2ccc(CNCC(C)(C)O)o2)cc1 |
| InChI | InChI=1S/C16H21NO2/c1-12-4-6-13(7-5-12)15-9-8-14(19-15)10-17-11-16(2,3)18/h4-9,17-18H,10-11H2,1-3H3 |
| InChIKey | LDIKOPGHOHZCSP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |