C16H23BrN2OS — CID 119128773
N-[(2-bromophenyl)methyl]-N-methyl-3-(thian-4-ylamino)propanamide (PubChem CID 119128773) has the molecular formula C16H23BrN2OS and a molecular weight of 371.34 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-methyl-3-(thian-4-ylamino)propanamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N-methyl-3-(thian-4-ylamino)propanamide |
|---|---|
| PubChem CID | 119128773 |
| Molecular Formula | C16H23BrN2OS |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-methyl-3-(thian-4-ylamino)propanamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CCNC1CCSCC1 |
| InChI | InChI=1S/C16H23BrN2OS/c1-19(12-13-4-2-3-5-15(13)17)16(20)6-9-18-14-7-10-21-11-8-14/h2-5,14,18H,6-12H2,1H3 |
| InChIKey | YIZJQEHQCHKEPE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |