C17H24BrN3O2 — CID 119321926
N-[3-[(2-bromophenyl)methyl-methylamino]-3-oxopropyl]piperidine-4-carboxamide (PubChem CID 119321926) has the molecular formula C17H24BrN3O2 and a molecular weight of 382.30 g/mol. Its IUPAC name is N-[3-[(2-bromophenyl)methyl-methylamino]-3-oxopropyl]piperidine-4-carboxamide.
| Compound Name | N-[3-[(2-bromophenyl)methyl-methylamino]-3-oxopropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119321926 |
| Molecular Formula | C17H24BrN3O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[3-[(2-bromophenyl)methyl-methylamino]-3-oxopropyl]piperidine-4-carboxamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CCNC(=O)C1CCNCC1 |
| InChI | InChI=1S/C17H24BrN3O2/c1-21(12-14-4-2-3-5-15(14)18)16(22)8-11-20-17(23)13-6-9-19-10-7-13/h2-5,13,19H,6-12H2,1H3,(H,20,23) |
| InChIKey | KDGRXNMFTJHAKR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |