C20H31BrN4O2 — CID 111768171
N-[(2-bromophenyl)methyl]-3-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-methylpropanamide (PubChem CID 111768171) has the molecular formula C20H31BrN4O2 and a molecular weight of 439.40 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-3-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-methylpropanamide.
| Compound Name | N-[(2-bromophenyl)methyl]-3-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 111768171 |
| Molecular Formula | C20H31BrN4O2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-3-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-methylpropanamide |
| SMILES | C/N=C(\NCCCOCC1CC1)NCCC(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C20H31BrN4O2/c1-22-20(23-11-5-13-27-15-16-8-9-16)24-12-10-19(26)25(2)14-17-6-3-4-7-18(17)21/h3-4,6-7,16H,5,8-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | KZIGRISPMCGGQJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|