C20H33BrN4O2 — CID 111763989
N-[(2-bromophenyl)methyl]-3-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-methylpropanamide (PubChem CID 111763989) has the molecular formula C20H33BrN4O2 and a molecular weight of 441.41 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-3-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-methylpropanamide.
| Compound Name | N-[(2-bromophenyl)methyl]-3-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 111763989 |
| Molecular Formula | C20H33BrN4O2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-3-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-methylpropanamide |
| SMILES | CCCCOCCCN/C(=N\C)NCCC(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C20H33BrN4O2/c1-4-5-14-27-15-8-12-23-20(22-2)24-13-11-19(26)25(3)16-17-9-6-7-10-18(17)21/h6-7,9-10H,4-5,8,11-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | BHWWPYRGOCKYKK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|