C20H30F2N2O3 — CID 119129341
1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-piperidin-1-yloxan-4-yl)methyl]methanamine (PubChem CID 119129341) has the molecular formula C20H30F2N2O3 and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-piperidin-1-yloxan-4-yl)methyl]methanamine.
| Compound Name | 1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-piperidin-1-yloxan-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 119129341 |
| Molecular Formula | C20H30F2N2O3 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4-piperidin-1-yloxan-4-yl)methyl]methanamine |
| SMILES | COc1cc(CNCC2(N3CCCCC3)CCOCC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H30F2N2O3/c1-25-18-13-16(5-6-17(18)27-19(21)22)14-23-15-20(7-11-26-12-8-20)24-9-3-2-4-10-24/h5-6,13,19,23H,2-4,7-12,14-15H2,1H3 |
| InChIKey | PVVBZVFEXVZBEH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |