C12H18F3N3O2 — CID 119133116
2-methyl-1-[1-(5-methylfuran-2-yl)ethyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine (PubChem CID 119133116) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-methyl-1-[1-(5-methylfuran-2-yl)ethyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine.
| Compound Name | 2-methyl-1-[1-(5-methylfuran-2-yl)ethyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine |
|---|---|
| PubChem CID | 119133116 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-methyl-1-[1-(5-methylfuran-2-yl)ethyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine |
| SMILES | C/N=C(\NCC(O)C(F)(F)F)NC(C)c1ccc(C)o1 |
| InChI | InChI=1S/C12H18F3N3O2/c1-7-4-5-9(20-7)8(2)18-11(16-3)17-6-10(19)12(13,14)15/h4-5,8,10,19H,6H2,1-3H3,(H2,16,17,18) |
| InChIKey | XTGUIFRHDWZJOL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|