C16H29IN4OS — CID 119156903
1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[1-(5-methylfuran-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 119156903) has the molecular formula C16H29IN4OS and a molecular weight of 452.41 g/mol. Its IUPAC name is 1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[1-(5-methylfuran-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[1-(5-methylfuran-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119156903 |
| Molecular Formula | C16H29IN4OS |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[1-(5-methylfuran-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(N(C)C)CCSC1)NC(C)c1ccc(C)o1.I |
| InChI | InChI=1S/C16H28N4OS.HI/c1-12-6-7-14(21-12)13(2)19-15(17-3)18-10-16(20(4)5)8-9-22-11-16;/h6-7,13H,8-11H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | QWFZKWZIMWGIQJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|