C14H25N5S2 — CID 119146414
1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 119146414) has the molecular formula C14H25N5S2 and a molecular weight of 327.52 g/mol. Its IUPAC name is 1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119146414 |
| Molecular Formula | C14H25N5S2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[[3-(dimethylamino)thiolan-3-yl]methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(C)cs1)NCC1(N(C)C)CCSC1 |
| InChI | InChI=1S/C14H25N5S2/c1-11-8-21-12(18-11)7-16-13(15-2)17-9-14(19(3)4)5-6-20-10-14/h8H,5-7,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | UAHNOLIITMHQHA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|