2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid

C13H20N2O2S — CID 119135138

IUPAC2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid
SMILESCCc1csc(C2CCCN(C(C)C(=O)O)C2)n1
InChIInChI=1S/C13H20N2O2S/c1-3-11-8-18-12(14-11)10-5-4-6-15(7-10)9(2)13(16)17/h8-10H,3-7H2,1-2H3,(H,16,17)
InChIKeySYZSDSSGNSVXGN-UHFFFAOYSA-N
MW268.38 g/mol
LogP2.36
Rot. Bonds4

About 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid

2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid (PubChem CID 119135138) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid.

Molecular Properties

Compound Name2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid
PubChem CID119135138
Molecular FormulaC13H20N2O2S
Molecular Weight268.38 g/mol
Exact Mass268.12
IUPAC Name2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid
SMILESCCc1csc(C2CCCN(C(C)C(=O)O)C2)n1
InChIInChI=1S/C13H20N2O2S/c1-3-11-8-18-12(14-11)10-5-4-6-15(7-10)9(2)13(16)17/h8-10H,3-7H2,1-2H3,(H,16,17)
InChIKeySYZSDSSGNSVXGN-UHFFFAOYSA-N
XLogP2.36
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.38
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid?
The IUPAC name of 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid (CID 119135138) is 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid.
What is the SMILES notation for 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid?
The canonical SMILES for 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid is CCc1csc(C2CCCN(C(C)C(=O)O)C2)n1.
What is the InChIKey of 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid?
The InChIKey is SYZSDSSGNSVXGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S/c1-3-11-8-18-12(14-11)10-5-4-6-15(7-10)9(2)13(16)17/h8-10H,3-7H2,1-2H3,(H,16,17).
What are the key properties of 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid?
2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid has a molecular weight of 268.38 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]propanoic acid is sourced from PubChem (CID 119135138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).