C15H23N3O3S — CID 122023263
4-[[3-(4-ethyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122023263) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-[[3-(4-ethyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[3-(4-ethyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122023263 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-[[3-(4-ethyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | CCc1csc(C2CCCN(C(=O)NCCCC(=O)O)C2)n1 |
| InChI | InChI=1S/C15H23N3O3S/c1-2-12-10-22-14(17-12)11-5-4-8-18(9-11)15(21)16-7-3-6-13(19)20/h10-11H,2-9H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | OHRVAYCDHVYEDC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|