C13H20N2O4 — CID 119136731
1-(1-methyl-2-oxopiperidine-4-carbonyl)piperidine-3-carboxylic acid (PubChem CID 119136731) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(1-methyl-2-oxopiperidine-4-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(1-methyl-2-oxopiperidine-4-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119136731 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(1-methyl-2-oxopiperidine-4-carbonyl)piperidine-3-carboxylic acid |
| SMILES | CN1CCC(C(=O)N2CCCC(C(=O)O)C2)CC1=O |
| InChI | InChI=1S/C13H20N2O4/c1-14-6-4-9(7-11(14)16)12(17)15-5-2-3-10(8-15)13(18)19/h9-10H,2-8H2,1H3,(H,18,19) |
| InChIKey | RVWOYEZCTHRJBL-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |