C23H31N3O5 — CID 11913798
[(2R)-1-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate (PubChem CID 11913798) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is [(2R)-1-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate.
| Compound Name | [(2R)-1-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 11913798 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [(2R)-1-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)[C@@H](C)OC(=O)CN1C(=O)N[C@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H31N3O5/c1-14-9-8-12-18(15(14)2)24-20(28)16(3)31-19(27)13-26-21(29)23(4,25-22(26)30)17-10-6-5-7-11-17/h5-7,10-11,14-16,18H,8-9,12-13H2,1-4H3,(H,24,28)(H,25,30)/t14-,15-,16-,18-,23-/m1/s1 |
| InChIKey | PLEKWYAEVNTNHM-GONFDNQISA-N |
| XLogP | 2.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|