C15H24N2O2S — CID 119138147
4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid (PubChem CID 119138147) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid.
| Compound Name | 4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 119138147 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid |
| SMILES | CC(C)c1csc(C2CCCN(CCCC(=O)O)C2)n1 |
| InChI | InChI=1S/C15H24N2O2S/c1-11(2)13-10-20-15(16-13)12-5-3-7-17(9-12)8-4-6-14(18)19/h10-12H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | ZHCGUXNZPHJPKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |