C19H22N2O3S — CID 119186414
4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidine-1-carbonyl]benzoic acid (PubChem CID 119186414) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidine-1-carbonyl]benzoic acid.
| Compound Name | 4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 119186414 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidine-1-carbonyl]benzoic acid |
| SMILES | CC(C)c1csc(C2CCCN(C(=O)c3ccc(C(=O)O)cc3)C2)n1 |
| InChI | InChI=1S/C19H22N2O3S/c1-12(2)16-11-25-17(20-16)15-4-3-9-21(10-15)18(22)13-5-7-14(8-6-13)19(23)24/h5-8,11-12,15H,3-4,9-10H2,1-2H3,(H,23,24) |
| InChIKey | FJVLFYDMVUSBQS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |