C19H25N3OS — CID 119893107
2-(4-aminophenyl)-1-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone (PubChem CID 119893107) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-aminophenyl)-1-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119893107 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-(4-aminophenyl)-1-[3-(4-propan-2-yl-1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
| SMILES | CC(C)c1csc(C2CCCN(C(=O)Cc3ccc(N)cc3)C2)n1 |
| InChI | InChI=1S/C19H25N3OS/c1-13(2)17-12-24-19(21-17)15-4-3-9-22(11-15)18(23)10-14-5-7-16(20)8-6-14/h5-8,12-13,15H,3-4,9-11,20H2,1-2H3 |
| InChIKey | DDAALIOMJMVZFJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|