C16H24IN3 — CID 119138382
N-(2-benzylcyclopropyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119138382) has the molecular formula C16H24IN3 and a molecular weight of 385.29 g/mol. Its IUPAC name is N-(2-benzylcyclopropyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(2-benzylcyclopropyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119138382 |
| Molecular Formula | C16H24IN3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(2-benzylcyclopropyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NC1CC1Cc1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C16H23N3.HI/c1-17-16(19-9-5-6-10-19)18-15-12-14(15)11-13-7-3-2-4-8-13;/h2-4,7-8,14-15H,5-6,9-12H2,1H3,(H,17,18);1H |
| InChIKey | SUFJIRAQVZJQFU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|