C21H25N3O — CID 119139089
N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylbutan-1-amine (PubChem CID 119139089) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylbutan-1-amine.
| Compound Name | N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylbutan-1-amine |
|---|---|
| PubChem CID | 119139089 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylbutan-1-amine |
| SMILES | CC(CCNC(C)c1nc(Cc2ccccc2)no1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c1-16(19-11-7-4-8-12-19)13-14-22-17(2)21-23-20(24-25-21)15-18-9-5-3-6-10-18/h3-12,16-17,22H,13-15H2,1-2H3 |
| InChIKey | SFRKBXVINIAAEA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |