C18H27N3O2 — CID 119139102
N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-1-methoxyhexan-2-amine (PubChem CID 119139102) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-1-methoxyhexan-2-amine.
| Compound Name | N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-1-methoxyhexan-2-amine |
|---|---|
| PubChem CID | 119139102 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-1-methoxyhexan-2-amine |
| SMILES | CCCCC(COC)NC(C)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C18H27N3O2/c1-4-5-11-16(13-22-3)19-14(2)18-20-17(21-23-18)12-15-9-7-6-8-10-15/h6-10,14,16,19H,4-5,11-13H2,1-3H3 |
| InChIKey | HMKKFBNEMZTPML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |