C15H26F3N3 — CID 119140565
1-(cyclobutylmethyl)-2-methyl-3-[[4-(trifluoromethyl)cyclohexyl]methyl]guanidine (PubChem CID 119140565) has the molecular formula C15H26F3N3 and a molecular weight of 305.39 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-methyl-3-[[4-(trifluoromethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-methyl-3-[[4-(trifluoromethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 119140565 |
| Molecular Formula | C15H26F3N3 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-methyl-3-[[4-(trifluoromethyl)cyclohexyl]methyl]guanidine |
| SMILES | C/N=C(\NCC1CCC1)NCC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H26F3N3/c1-19-14(20-9-11-3-2-4-11)21-10-12-5-7-13(8-6-12)15(16,17)18/h11-13H,2-10H2,1H3,(H2,19,20,21) |
| InChIKey | NJNFBLFTDDIRLU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|