C9H16ClN3 — CID 119141171
2-(2-chloroprop-2-enyl)-1-cyclopropyl-3-ethylguanidine (PubChem CID 119141171) has the molecular formula C9H16ClN3 and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-(2-chloroprop-2-enyl)-1-cyclopropyl-3-ethylguanidine.
| Compound Name | 2-(2-chloroprop-2-enyl)-1-cyclopropyl-3-ethylguanidine |
|---|---|
| PubChem CID | 119141171 |
| Molecular Formula | C9H16ClN3 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(2-chloroprop-2-enyl)-1-cyclopropyl-3-ethylguanidine |
| SMILES | C=C(Cl)C/N=C(\NCC)NC1CC1 |
| InChI | InChI=1S/C9H16ClN3/c1-3-11-9(12-6-7(2)10)13-8-4-5-8/h8H,2-6H2,1H3,(H2,11,12,13) |
| InChIKey | RETAHXQJAXOXNH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|