C12H25IN4O — CID 119145472
N,N-dimethyl-2-[[[(2-methylcyclopropyl)amino]-(propan-2-ylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 119145472) has the molecular formula C12H25IN4O and a molecular weight of 368.26 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(2-methylcyclopropyl)amino]-(propan-2-ylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(2-methylcyclopropyl)amino]-(propan-2-ylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 119145472 |
| Molecular Formula | C12H25IN4O |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N,N-dimethyl-2-[[[(2-methylcyclopropyl)amino]-(propan-2-ylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)N/C(=N\CC(=O)N(C)C)NC1CC1C.I |
| InChI | InChI=1S/C12H24N4O.HI/c1-8(2)14-12(15-10-6-9(10)3)13-7-11(17)16(4)5;/h8-10H,6-7H2,1-5H3,(H2,13,14,15);1H |
| InChIKey | RDDIGAWVKRMXCI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|