C13H26IN5O2 — CID 119149700
2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylcyclopropyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 119149700) has the molecular formula C13H26IN5O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylcyclopropyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylcyclopropyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119149700 |
| Molecular Formula | C13H26IN5O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylcyclopropyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC1CC1N/C(=N/CC(=O)N(C)C)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C13H25N5O2.HI/c1-9-6-10(9)16-13(14-7-11(19)17(2)3)15-8-12(20)18(4)5;/h9-10H,6-8H2,1-5H3,(H2,14,15,16);1H |
| InChIKey | KIUAQGJQQXEBGK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|