C19H39IN4OS — CID 110033792
N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-(6-methylsulfanylhexylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110033792) has the molecular formula C19H39IN4OS and a molecular weight of 498.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-(6-methylsulfanylhexylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-(6-methylsulfanylhexylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110033792 |
| Molecular Formula | C19H39IN4OS |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-(6-methylsulfanylhexylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CSCCCCCCN/C(=N\CC(=O)N(C)C)NC1CCCCC1C.I |
| InChI | InChI=1S/C19H38N4OS.HI/c1-16-11-7-8-12-17(16)22-19(21-15-18(24)23(2)3)20-13-9-5-6-10-14-25-4;/h16-17H,5-15H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | AJGORJUTLOUCHB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|