C24H40N4O3 — CID 110036209
N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-[3-(2-phenylmethoxyethoxy)propylamino]methylidene]amino]acetamide (PubChem CID 110036209) has the molecular formula C24H40N4O3 and a molecular weight of 432.61 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-[3-(2-phenylmethoxyethoxy)propylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-[3-(2-phenylmethoxyethoxy)propylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036209 |
| Molecular Formula | C24H40N4O3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | N,N-dimethyl-2-[[[(2-methylcyclohexyl)amino]-[3-(2-phenylmethoxyethoxy)propylamino]methylidene]amino]acetamide |
| SMILES | CC1CCCCC1N/C(=N/CC(=O)N(C)C)NCCCOCCOCc1ccccc1 |
| InChI | InChI=1S/C24H40N4O3/c1-20-10-7-8-13-22(20)27-24(26-18-23(29)28(2)3)25-14-9-15-30-16-17-31-19-21-11-5-4-6-12-21/h4-6,11-12,20,22H,7-10,13-19H2,1-3H3,(H2,25,26,27) |
| InChIKey | JADDIBQJLWBUHB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|