C23H36N6O — CID 111841998
N,N-dimethyl-2-[[[3-(2-methylbenzimidazol-1-yl)propylamino]-[(2-methylcyclohexyl)amino]methylidene]amino]acetamide (PubChem CID 111841998) has the molecular formula C23H36N6O and a molecular weight of 412.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(2-methylbenzimidazol-1-yl)propylamino]-[(2-methylcyclohexyl)amino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(2-methylbenzimidazol-1-yl)propylamino]-[(2-methylcyclohexyl)amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111841998 |
| Molecular Formula | C23H36N6O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(2-methylbenzimidazol-1-yl)propylamino]-[(2-methylcyclohexyl)amino]methylidene]amino]acetamide |
| SMILES | Cc1nc2ccccc2n1CCCN/C(=N\CC(=O)N(C)C)NC1CCCCC1C |
| InChI | InChI=1S/C23H36N6O/c1-17-10-5-6-11-19(17)27-23(25-16-22(30)28(3)4)24-14-9-15-29-18(2)26-20-12-7-8-13-21(20)29/h7-8,12-13,17,19H,5-6,9-11,14-16H2,1-4H3,(H2,24,25,27) |
| InChIKey | LWLULTQFXSKROA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|