C22H34N6O — CID 111352652
N-cyclohexyl-2-[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]acetamide (PubChem CID 111352652) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111352652 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C22H34N6O/c1-3-23-22(25-16-21(29)27-18-10-5-4-6-11-18)24-14-9-15-28-17(2)26-19-12-7-8-13-20(19)28/h7-8,12-13,18H,3-6,9-11,14-16H2,1-2H3,(H,27,29)(H2,23,24,25) |
| InChIKey | WFUMOEPTCVBONZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|