C22H26N2O3S — CID 11914718
2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 11914718) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 11914718 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | Cc1ccc(/C=C2\SC(=O)N(CCNC(=O)C[C@@H]3C[C@H]4CC[C@@H]3C4)C2=O)cc1 |
| InChI | InChI=1S/C22H26N2O3S/c1-14-2-4-15(5-3-14)12-19-21(26)24(22(27)28-19)9-8-23-20(25)13-18-11-16-6-7-17(18)10-16/h2-5,12,16-18H,6-11,13H2,1H3,(H,23,25)/b19-12-/t16-,17+,18-/m0/s1 |
| InChIKey | HBAJAVDKFKXUKF-XZRBOQLQSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|