C21H23FN2O5S — CID 145124156
2-[(1R,2R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 145124156) has the molecular formula C21H23FN2O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[(1R,2R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-[(1R,2R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 145124156 |
| Molecular Formula | C21H23FN2O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-[(1R,2R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | O=C(C[C@H]1C[C@@H]2C[C@H]1[C@@H](O)[C@H]2O)NCCN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H23FN2O5S/c22-14-3-1-11(2-4-14)7-16-20(28)24(21(29)30-16)6-5-23-17(25)10-12-8-13-9-15(12)19(27)18(13)26/h1-4,7,12-13,15,18-19,26-27H,5-6,8-10H2,(H,23,25)/b16-7-/t12-,13-,15-,18+,19-/m1/s1 |
| InChIKey | WTMTZTIGIPXEIO-BQSOZZERSA-N |
| XLogP | 1.75 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|