C17H34N6 — CID 119150073
1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine (PubChem CID 119150073) has the molecular formula C17H34N6 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine.
| Compound Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119150073 |
| Molecular Formula | C17H34N6 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCN1CCCN(C)CC1)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C17H34N6/c1-18-17(20-15-6-10-23(14-15)16-4-5-16)19-7-11-22-9-3-8-21(2)12-13-22/h15-16H,3-14H2,1-2H3,(H2,18,19,20) |
| InChIKey | CPIQUOXAFPPVRG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|