C15H26N6 — CID 119158419
1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine (PubChem CID 119158419) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119158419 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cc(C)cn1)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H26N6/c1-12-9-18-21(10-12)8-6-17-15(16-2)19-13-5-7-20(11-13)14-3-4-14/h9-10,13-14H,3-8,11H2,1-2H3,(H2,16,17,19) |
| InChIKey | AJACAVIAEWGBII-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|