C16H21BrN4O2 — CID 119150474
1-(2-bromoprop-2-enyl)-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine (PubChem CID 119150474) has the molecular formula C16H21BrN4O2 and a molecular weight of 381.27 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine.
| Compound Name | 1-(2-bromoprop-2-enyl)-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 119150474 |
| Molecular Formula | C16H21BrN4O2 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine |
| SMILES | C=C(Br)CN/C(=N\C)NC1CC(=O)N(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C16H21BrN4O2/c1-11(17)9-19-16(18-2)20-12-7-15(22)21(10-12)13-5-4-6-14(8-13)23-3/h4-6,8,12H,1,7,9-10H2,2-3H3,(H2,18,19,20) |
| InChIKey | PKWPMNZZRHSLDR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|