C19H26IN5O3 — CID 119150499
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 119150499) has the molecular formula C19H26IN5O3 and a molecular weight of 499.35 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119150499 |
| Molecular Formula | C19H26IN5O3 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)noc1C)NC1CC(=O)N(c2cccc(OC)c2)C1.I |
| InChI | InChI=1S/C19H25N5O3.HI/c1-12-17(13(2)27-23-12)10-21-19(20-3)22-14-8-18(25)24(11-14)15-6-5-7-16(9-15)26-4;/h5-7,9,14H,8,10-11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | LURYQPAUXPOPEV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|