C16H30N4O2 — CID 119150730
1-(1-cyclopentylpyrrolidin-3-yl)-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine (PubChem CID 119150730) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119150730 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCC1COCCO1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C16H30N4O2/c1-17-16(18-10-15-12-21-8-9-22-15)19-13-6-7-20(11-13)14-4-2-3-5-14/h13-15H,2-12H2,1H3,(H2,17,18,19) |
| InChIKey | ROHFTQHRKYHRAR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|