C12H23IN4O — CID 119150765
1-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 119150765) has the molecular formula C12H23IN4O and a molecular weight of 366.25 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 1-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119150765 |
| Molecular Formula | C12H23IN4O |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NC1CCN(CCOC)C1.I |
| InChI | InChI=1S/C12H22N4O.HI/c1-4-6-14-12(13-2)15-11-5-7-16(10-11)8-9-17-3;/h1,11H,5-10H2,2-3H3,(H2,13,14,15);1H |
| InChIKey | YXPWKIWEABUPDU-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|