C21H33IN4O — CID 119151514
1-ethyl-3-(oxan-4-ylmethyl)-2-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine;hydroiodide (PubChem CID 119151514) has the molecular formula C21H33IN4O and a molecular weight of 484.43 g/mol. Its IUPAC name is 1-ethyl-3-(oxan-4-ylmethyl)-2-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(oxan-4-ylmethyl)-2-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151514 |
| Molecular Formula | C21H33IN4O |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-ethyl-3-(oxan-4-ylmethyl)-2-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C)cc2c(C)c(C)[nH]c12)NCC1CCOCC1.I |
| InChI | InChI=1S/C21H32N4O.HI/c1-5-22-21(23-12-17-6-8-26-9-7-17)24-13-18-10-14(2)11-19-15(3)16(4)25-20(18)19;/h10-11,17,25H,5-9,12-13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | WKJINJPNAKKOFD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|