C16H26N6O — CID 119152825
3-(2,5-dihydropyrrol-1-yl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 119152825) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119152825 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | CCc1nc(CCN/C(=N\C)N2CCC(N3CC=CC3)C2)no1 |
| InChI | InChI=1S/C16H26N6O/c1-3-15-19-14(20-23-15)6-8-18-16(17-2)22-11-7-13(12-22)21-9-4-5-10-21/h4-5,13H,3,6-12H2,1-2H3,(H,17,18) |
| InChIKey | QXPLPWDVABRIPZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|