C19H23N3O2 — CID 119153455
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 119153455) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 119153455 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | COc1cccc(-c2noc(C(C)NCC3CC4C=CC3C4)n2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-12(20-11-16-9-13-6-7-14(16)8-13)19-21-18(22-24-19)15-4-3-5-17(10-15)23-2/h3-7,10,12-14,16,20H,8-9,11H2,1-2H3 |
| InChIKey | QRQCSXQEEXCEEG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|