C18H29N3O3 — CID 119156986
N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methyl-2-oxa-8-azaspiro[5.5]undecane-8-carboximidamide (PubChem CID 119156986) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methyl-2-oxa-8-azaspiro[5.5]undecane-8-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methyl-2-oxa-8-azaspiro[5.5]undecane-8-carboximidamide |
|---|---|
| PubChem CID | 119156986 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-methyl-2-oxa-8-azaspiro[5.5]undecane-8-carboximidamide |
| SMILES | C/N=C(\NCC(C)(O)c1ccco1)N1CCCC2(CCCOC2)C1 |
| InChI | InChI=1S/C18H29N3O3/c1-17(22,15-6-3-11-24-15)12-20-16(19-2)21-9-4-7-18(13-21)8-5-10-23-14-18/h3,6,11,22H,4-5,7-10,12-14H2,1-2H3,(H,19,20) |
| InChIKey | UJEJHSZAXNGPES-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|