C18H31N5O — CID 119160818
N'-methyl-N-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 119160818) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is N'-methyl-N-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N'-methyl-N-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 119160818 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N'-methyl-N-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCc1nccn1CC(C)C)N1CCC2(CCOCC2)C1 |
| InChI | InChI=1S/C18H31N5O/c1-15(2)13-22-9-7-20-16(22)12-21-17(19-3)23-8-4-18(14-23)5-10-24-11-6-18/h7,9,15H,4-6,8,10-14H2,1-3H3,(H,19,21) |
| InChIKey | AMLYZKDNQAOYOE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|