C19H27N3OS — CID 119161275
N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 119161275) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 119161275 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(O)CCSC1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3OS/c1-2-20-18(21-14-19(23)10-13-24-15-19)22-11-8-17(9-12-22)16-6-4-3-5-7-16/h3-8,23H,2,9-15H2,1H3,(H,20,21) |
| InChIKey | RLQODGGJCPQHFJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|