C20H22N2O4S — CID 119167123
1-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylic acid (PubChem CID 119167123) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119167123 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N1CCCC(C(=O)O)C1)c1cccs1 |
| InChI | InChI=1S/C20H22N2O4S/c23-18(17-9-5-11-27-17)21-16(12-14-6-2-1-3-7-14)19(24)22-10-4-8-15(13-22)20(25)26/h1-3,5-7,9,11,15-16H,4,8,10,12-13H2,(H,21,23)(H,25,26) |
| InChIKey | DHNUKLQKNQCXBI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |