C13H23NO5 — CID 119167924
1-[2-(2-ethoxyethoxy)propanoyl]piperidine-3-carboxylic acid (PubChem CID 119167924) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-[2-(2-ethoxyethoxy)propanoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(2-ethoxyethoxy)propanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119167924 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-[2-(2-ethoxyethoxy)propanoyl]piperidine-3-carboxylic acid |
| SMILES | CCOCCOC(C)C(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C13H23NO5/c1-3-18-7-8-19-10(2)12(15)14-6-4-5-11(9-14)13(16)17/h10-11H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | CKPBGSMEXJIAGW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|