C16H17FN2O3 — CID 119168017
1-[(4-fluoro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 119168017) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[(4-fluoro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4-fluoro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119168017 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[(4-fluoro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCCC1)c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C16H17FN2O3/c17-11-5-4-6-12-10(11)9-13(18-12)14(20)19-16(15(21)22)7-2-1-3-8-16/h4-6,9,18H,1-3,7-8H2,(H,19,20)(H,21,22) |
| InChIKey | VIWJYTOYKKUXOG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |