C23H24N2O4 — CID 119168568
1-(6-ethoxy-1H-indole-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 119168568) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-(6-ethoxy-1H-indole-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(6-ethoxy-1H-indole-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119168568 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-(6-ethoxy-1H-indole-2-carbonyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | CCOc1ccc2cc(C(=O)N3CCC(C(=O)O)(c4ccccc4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C23H24N2O4/c1-2-29-18-9-8-16-14-20(24-19(16)15-18)21(26)25-12-10-23(11-13-25,22(27)28)17-6-4-3-5-7-17/h3-9,14-15,24H,2,10-13H2,1H3,(H,27,28) |
| InChIKey | BGOVGYPBNOXPAK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |