C18H22N2O3 — CID 94487538
[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(6-ethoxy-1H-indol-2-yl)methanone (PubChem CID 94487538) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(6-ethoxy-1H-indol-2-yl)methanone.
| Compound Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(6-ethoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 94487538 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(6-ethoxy-1H-indol-2-yl)methanone |
| SMILES | CCOc1ccc2cc(C(=O)N3CCO[C@@H]4CCC[C@@H]43)[nH]c2c1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-22-13-7-6-12-10-15(19-14(12)11-13)18(21)20-8-9-23-17-5-3-4-16(17)20/h6-7,10-11,16-17,19H,2-5,8-9H2,1H3/t16-,17+/m0/s1 |
| InChIKey | GZDOKVWCYGRYHK-DLBZAZTESA-N |
| XLogP | 2.96 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |