C21H21FN2O2 — CID 55829589
N-cyclopropyl-6-ethoxy-N-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 55829589) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-cyclopropyl-6-ethoxy-N-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | N-cyclopropyl-6-ethoxy-N-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55829589 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-cyclopropyl-6-ethoxy-N-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | CCOc1ccc2cc(C(=O)N(Cc3cccc(F)c3)C3CC3)[nH]c2c1 |
| InChI | InChI=1S/C21H21FN2O2/c1-2-26-18-9-6-15-11-20(23-19(15)12-18)21(25)24(17-7-8-17)13-14-4-3-5-16(22)10-14/h3-6,9-12,17,23H,2,7-8,13H2,1H3 |
| InChIKey | NFASIGYHEILQBS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |