C18H22FN3O3 — CID 119172739
4-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]-methylamino]butanoic acid (PubChem CID 119172739) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]-methylamino]butanoic acid.
| Compound Name | 4-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119172739 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]-methylamino]butanoic acid |
| SMILES | CC(C)c1c(C(=O)N(C)CCCC(=O)O)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O3/c1-12(2)17-15(18(25)21(3)10-4-5-16(23)24)11-20-22(17)14-8-6-13(19)7-9-14/h6-9,11-12H,4-5,10H2,1-3H3,(H,23,24) |
| InChIKey | ABJDKOBPZMSZCY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |