C19H21NO4 — CID 119172841
4-[methyl-(2-phenoxy-2-phenylacetyl)amino]butanoic acid (PubChem CID 119172841) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[methyl-(2-phenoxy-2-phenylacetyl)amino]butanoic acid.
| Compound Name | 4-[methyl-(2-phenoxy-2-phenylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119172841 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[methyl-(2-phenoxy-2-phenylacetyl)amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)C(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c1-20(14-8-13-17(21)22)19(23)18(15-9-4-2-5-10-15)24-16-11-6-3-7-12-16/h2-7,9-12,18H,8,13-14H2,1H3,(H,21,22) |
| InChIKey | OAKWVCAVSXNOIH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |